C19H18FN3O2S — CID 3474570
3-(4-fluorophenyl)-N-[(3-phenylpropanoylamino)carbamothioyl]prop-2-enamide (PubChem CID 3474570) has the molecular formula C19H18FN3O2S and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[(3-phenylpropanoylamino)carbamothioyl]prop-2-enamide.
| Compound Name | 3-(4-fluorophenyl)-N-[(3-phenylpropanoylamino)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 3474570 |
| Molecular Formula | C19H18FN3O2S |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[(3-phenylpropanoylamino)carbamothioyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(F)cc1)NC(=S)NNC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C19H18FN3O2S/c20-16-10-6-15(7-11-16)8-12-17(24)21-19(26)23-22-18(25)13-9-14-4-2-1-3-5-14/h1-8,10-12H,9,13H2,(H,22,25)(H2,21,23,24,26) |
| InChIKey | VXLHAJGDFSZHCF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|