C26H25N3O3S — CID 17233696
N-[4-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]carbamothioylamino]phenyl]-3-phenylpropanamide (PubChem CID 17233696) has the molecular formula C26H25N3O3S and a molecular weight of 459.57 g/mol. Its IUPAC name is N-[4-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]carbamothioylamino]phenyl]-3-phenylpropanamide.
| Compound Name | N-[4-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]carbamothioylamino]phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 17233696 |
| Molecular Formula | C26H25N3O3S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | N-[4-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]carbamothioylamino]phenyl]-3-phenylpropanamide |
| SMILES | COc1ccc(/C=C/C(=O)NC(=S)Nc2ccc(NC(=O)CCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H25N3O3S/c1-32-23-15-7-20(8-16-23)10-18-25(31)29-26(33)28-22-13-11-21(12-14-22)27-24(30)17-9-19-5-3-2-4-6-19/h2-8,10-16,18H,9,17H2,1H3,(H,27,30)(H2,28,29,31,33)/b18-10+ |
| InChIKey | FCLVADUKPFHXCA-VCHYOVAHSA-N |
| XLogP | 4.79 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|