C20H18ClFN4O3S — CID 2062475
N-(2-chlorophenyl)-4-[2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]carbamothioyl]hydrazinyl]-4-oxobutanamide (PubChem CID 2062475) has the molecular formula C20H18ClFN4O3S and a molecular weight of 448.91 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-[2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]carbamothioyl]hydrazinyl]-4-oxobutanamide.
| Compound Name | N-(2-chlorophenyl)-4-[2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]carbamothioyl]hydrazinyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 2062475 |
| Molecular Formula | C20H18ClFN4O3S |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | N-(2-chlorophenyl)-4-[2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]carbamothioyl]hydrazinyl]-4-oxobutanamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)NC(=S)NNC(=O)CCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C20H18ClFN4O3S/c21-15-3-1-2-4-16(15)23-17(27)11-12-19(29)25-26-20(30)24-18(28)10-7-13-5-8-14(22)9-6-13/h1-10H,11-12H2,(H,23,27)(H,25,29)(H2,24,26,28,30)/b10-7+ |
| InChIKey | VHDJCFGNWPQDKJ-JXMROGBWSA-N |
| XLogP | 2.93 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|