C23H26FN3O2 — CID 9161760
(E)-3-[4-(azepan-1-yl)phenyl]-N'-[2-(4-fluorophenyl)acetyl]prop-2-enehydrazide (PubChem CID 9161760) has the molecular formula C23H26FN3O2 and a molecular weight of 395.48 g/mol. Its IUPAC name is (E)-3-[4-(azepan-1-yl)phenyl]-N'-[2-(4-fluorophenyl)acetyl]prop-2-enehydrazide.
| Compound Name | (E)-3-[4-(azepan-1-yl)phenyl]-N'-[2-(4-fluorophenyl)acetyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 9161760 |
| Molecular Formula | C23H26FN3O2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (E)-3-[4-(azepan-1-yl)phenyl]-N'-[2-(4-fluorophenyl)acetyl]prop-2-enehydrazide |
| SMILES | O=C(/C=C/c1ccc(N2CCCCCC2)cc1)NNC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H26FN3O2/c24-20-10-5-19(6-11-20)17-23(29)26-25-22(28)14-9-18-7-12-21(13-8-18)27-15-3-1-2-4-16-27/h5-14H,1-4,15-17H2,(H,25,28)(H,26,29)/b14-9+ |
| InChIKey | RHOVZQNZUFXYMM-NTEUORMPSA-N |
| XLogP | 3.61 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|