C11H11BN2O2 — CID 59416194
CID 59416194 (PubChem CID 59416194) has the molecular formula C11H11BN2O2 and a molecular weight of 214.03 g/mol.
| Compound Name | CID 59416194 |
|---|---|
| PubChem CID | 59416194 |
| Molecular Formula | C11H11BN2O2 |
| Molecular Weight | 214.03 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | — |
| SMILES | [B]/C=C\C(=O)NNC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C11H11BN2O2/c12-7-6-10(15)13-14-11(16)8-9-4-2-1-3-5-9/h1-7H,8H2,(H,13,15)(H,14,16)/b7-6- |
| InChIKey | FOMAFUUYLGDZDH-SREVYHEPSA-N |
| XLogP | 0.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.03 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|