About (E)-N'-butyl-3-phenylprop-2-enimidamide;hydrochloride
(E)-N'-butyl-3-phenylprop-2-enimidamide;hydrochloride (PubChem CID 69131247) has the molecular formula C13H19ClN2
and a molecular weight of 238.76 g/mol. Its IUPAC name is (E)-N'-butyl-3-phenylprop-2-enimidamide;hydrochloride.
Molecular Properties
| Compound Name | (E)-N'-butyl-3-phenylprop-2-enimidamide;hydrochloride |
| PubChem CID | 69131247 |
| Molecular Formula | C13H19ClN2 |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (E)-N'-butyl-3-phenylprop-2-enimidamide;hydrochloride |
| SMILES | CCCC/N=C(N)/C=C/c1ccccc1.Cl |
| InChI | InChI=1S/C13H18N2.ClH/c1-2-3-11-15-13(14)10-9-12-7-5-4-6-8-12;/h4-10H,2-3,11H2,1H3,(H2,14,15);1H/b10-9+; |
| InChIKey | KZUDAKOOEIQQNX-RRABGKBLSA-N |
| XLogP | 3.28 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-butyl-3-phenylprop-2-enimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-butyl-3-phenylprop-2-enimidamide;hydrochloride?
The IUPAC name of (E)-N'-butyl-3-phenylprop-2-enimidamide;hydrochloride (CID 69131247) is (E)-N'-butyl-3-phenylprop-2-enimidamide;hydrochloride.
What is the SMILES notation for (E)-N'-butyl-3-phenylprop-2-enimidamide;hydrochloride?
The canonical SMILES for (E)-N'-butyl-3-phenylprop-2-enimidamide;hydrochloride is CCCC/N=C(N)/C=C/c1ccccc1.Cl.
What is the InChIKey of (E)-N'-butyl-3-phenylprop-2-enimidamide;hydrochloride?
The InChIKey is KZUDAKOOEIQQNX-RRABGKBLSA-N. The full InChI is InChI=1S/C13H18N2.ClH/c1-2-3-11-15-13(14)10-9-12-7-5-4-6-8-12;/h4-10H,2-3,11H2,1H3,(H2,14,15);1H/b10-9+;.
What are the key properties of (E)-N'-butyl-3-phenylprop-2-enimidamide;hydrochloride?
(E)-N'-butyl-3-phenylprop-2-enimidamide;hydrochloride has a molecular weight of 238.76 g/mol, XLogP of 3.28, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-butyl-3-phenylprop-2-enimidamide;hydrochloride is sourced from PubChem (CID 69131247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).