C11H16N2O — CID 12936228
N'-butyl-N-hydroxybenzenecarboximidamide (PubChem CID 12936228) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is N'-butyl-N-hydroxybenzenecarboximidamide.
| Compound Name | N'-butyl-N-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 12936228 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | N'-butyl-N-hydroxybenzenecarboximidamide |
| SMILES | CCCC/N=C(\NO)c1ccccc1 |
| InChI | InChI=1S/C11H16N2O/c1-2-3-9-12-11(13-14)10-7-5-4-6-8-10/h4-8,14H,2-3,9H2,1H3,(H,12,13) |
| InChIKey | RXAXYDIHFXRRHE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|