C9H12N2O3S — CID 3425755
N'-ethylsulfonyl-N-hydroxybenzenecarboximidamide (PubChem CID 3425755) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is N'-ethylsulfonyl-N-hydroxybenzenecarboximidamide.
| Compound Name | N'-ethylsulfonyl-N-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 3425755 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | N'-ethylsulfonyl-N-hydroxybenzenecarboximidamide |
| SMILES | CCS(=O)(=O)N=C(NO)c1ccccc1 |
| InChI | InChI=1S/C9H12N2O3S/c1-2-15(13,14)11-9(10-12)8-6-4-3-5-7-8/h3-7,12H,2H2,1H3,(H,10,11) |
| InChIKey | QQMOMRNWORLRLW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|