C41H36N4O4S2 — CID 4704513
N'-(4-methylphenyl)sulfonyl-N-[4-[[4-[[N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]amino]phenyl]methyl]phenyl]benzenecarboximidamide (PubChem CID 4704513) has the molecular formula C41H36N4O4S2 and a molecular weight of 712.90 g/mol. Its IUPAC name is N'-(4-methylphenyl)sulfonyl-N-[4-[[4-[[N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]amino]phenyl]methyl]phenyl]benzenecarboximidamide.
| Compound Name | N'-(4-methylphenyl)sulfonyl-N-[4-[[4-[[N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]amino]phenyl]methyl]phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 4704513 |
| Molecular Formula | C41H36N4O4S2 |
| Molecular Weight | 712.90 g/mol |
| Exact Mass | 712.22 |
| IUPAC Name | N'-(4-methylphenyl)sulfonyl-N-[4-[[4-[[N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]amino]phenyl]methyl]phenyl]benzenecarboximidamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C(Nc2ccc(Cc3ccc(NC(=NS(=O)(=O)c4ccc(C)cc4)c4ccccc4)cc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C41H36N4O4S2/c1-30-13-25-38(26-14-30)50(46,47)44-40(34-9-5-3-6-10-34)42-36-21-17-32(18-22-36)29-33-19-23-37(24-20-33)43-41(35-11-7-4-8-12-35)45-51(48,49)39-27-15-31(2)16-28-39/h3-28H,29H2,1-2H3,(H,42,44)(H,43,45) |
| InChIKey | CZOLXFHMSLUNCS-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.90 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|