C19H15ClN2O2S — CID 6387422
N'-(benzenesulfonyl)-N-(4-chlorophenyl)benzenecarboximidamide (PubChem CID 6387422) has the molecular formula C19H15ClN2O2S and a molecular weight of 370.86 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-N-(4-chlorophenyl)benzenecarboximidamide.
| Compound Name | N'-(benzenesulfonyl)-N-(4-chlorophenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 6387422 |
| Molecular Formula | C19H15ClN2O2S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | N'-(benzenesulfonyl)-N-(4-chlorophenyl)benzenecarboximidamide |
| SMILES | O=S(=O)(/N=C(/Nc1ccc(Cl)cc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H15ClN2O2S/c20-16-11-13-17(14-12-16)21-19(15-7-3-1-4-8-15)22-25(23,24)18-9-5-2-6-10-18/h1-14H,(H,21,22) |
| InChIKey | TWMHELRLOSSGEE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|