C20H16ClN3O2S2 — CID 2303517
1-[N-(benzenesulfonyl)-C-phenylcarbonimidoyl]-3-(4-chlorophenyl)thiourea (PubChem CID 2303517) has the molecular formula C20H16ClN3O2S2 and a molecular weight of 429.95 g/mol. Its IUPAC name is 1-[N-(benzenesulfonyl)-C-phenylcarbonimidoyl]-3-(4-chlorophenyl)thiourea.
| Compound Name | 1-[N-(benzenesulfonyl)-C-phenylcarbonimidoyl]-3-(4-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 2303517 |
| Molecular Formula | C20H16ClN3O2S2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 1-[N-(benzenesulfonyl)-C-phenylcarbonimidoyl]-3-(4-chlorophenyl)thiourea |
| SMILES | O=S(=O)(N=C(NC(=S)Nc1ccc(Cl)cc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H16ClN3O2S2/c21-16-11-13-17(14-12-16)22-20(27)23-19(15-7-3-1-4-8-15)24-28(25,26)18-9-5-2-6-10-18/h1-14H,(H2,22,23,24,27) |
| InChIKey | JGFWUUNRFQPDKF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|