C27H31ClN2O3S — CID 34071723
N'-(4-chlorophenyl)sulfonyl-N-(3,5-ditert-butyl-4-hydroxyphenyl)benzenecarboximidamide (PubChem CID 34071723) has the molecular formula C27H31ClN2O3S and a molecular weight of 499.08 g/mol. Its IUPAC name is N'-(4-chlorophenyl)sulfonyl-N-(3,5-ditert-butyl-4-hydroxyphenyl)benzenecarboximidamide.
| Compound Name | N'-(4-chlorophenyl)sulfonyl-N-(3,5-ditert-butyl-4-hydroxyphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 34071723 |
| Molecular Formula | C27H31ClN2O3S |
| Molecular Weight | 499.08 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | N'-(4-chlorophenyl)sulfonyl-N-(3,5-ditert-butyl-4-hydroxyphenyl)benzenecarboximidamide |
| SMILES | CC(C)(C)c1cc(NC(=NS(=O)(=O)c2ccc(Cl)cc2)c2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C27H31ClN2O3S/c1-26(2,3)22-16-20(17-23(24(22)31)27(4,5)6)29-25(18-10-8-7-9-11-18)30-34(32,33)21-14-12-19(28)13-15-21/h7-17,31H,1-6H3,(H,29,30) |
| InChIKey | MXZZLXXPFZTYFF-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.08 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|