C28H34N2O3S — CID 34071712
N-(3,5-ditert-butyl-4-hydroxyphenyl)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide (PubChem CID 34071712) has the molecular formula C28H34N2O3S and a molecular weight of 478.66 g/mol. Its IUPAC name is N-(3,5-ditert-butyl-4-hydroxyphenyl)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide.
| Compound Name | N-(3,5-ditert-butyl-4-hydroxyphenyl)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 34071712 |
| Molecular Formula | C28H34N2O3S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | N-(3,5-ditert-butyl-4-hydroxyphenyl)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C(Nc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H34N2O3S/c1-19-13-15-22(16-14-19)34(32,33)30-26(20-11-9-8-10-12-20)29-21-17-23(27(2,3)4)25(31)24(18-21)28(5,6)7/h8-18,31H,1-7H3,(H,29,30) |
| InChIKey | TVFDRRIFHHCZNY-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|