C23H24N2O3S — CID 134879097
N'-(benzenesulfonyl)-N-(4-hydroxy-2,3,5,6-tetramethylphenyl)benzenecarboximidamide (PubChem CID 134879097) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-N-(4-hydroxy-2,3,5,6-tetramethylphenyl)benzenecarboximidamide.
| Compound Name | N'-(benzenesulfonyl)-N-(4-hydroxy-2,3,5,6-tetramethylphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 134879097 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N'-(benzenesulfonyl)-N-(4-hydroxy-2,3,5,6-tetramethylphenyl)benzenecarboximidamide |
| SMILES | Cc1c(C)c(N/C(=N/S(=O)(=O)c2ccccc2)c2ccccc2)c(C)c(C)c1O |
| InChI | InChI=1S/C23H24N2O3S/c1-15-17(3)22(26)18(4)16(2)21(15)24-23(19-11-7-5-8-12-19)25-29(27,28)20-13-9-6-10-14-20/h5-14,26H,1-4H3,(H,24,25) |
| InChIKey | SFBXMAUIPOBINA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|