C20H14Br4N2O3S — CID 15517229
N'-(4-methylphenyl)sulfonyl-N-(2,3,5,6-tetrabromo-4-hydroxyphenyl)benzenecarboximidamide (PubChem CID 15517229) has the molecular formula C20H14Br4N2O3S and a molecular weight of 682.03 g/mol. Its IUPAC name is N'-(4-methylphenyl)sulfonyl-N-(2,3,5,6-tetrabromo-4-hydroxyphenyl)benzenecarboximidamide.
| Compound Name | N'-(4-methylphenyl)sulfonyl-N-(2,3,5,6-tetrabromo-4-hydroxyphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 15517229 |
| Molecular Formula | C20H14Br4N2O3S |
| Molecular Weight | 682.03 g/mol |
| Exact Mass | 677.75 |
| IUPAC Name | N'-(4-methylphenyl)sulfonyl-N-(2,3,5,6-tetrabromo-4-hydroxyphenyl)benzenecarboximidamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C(/Nc2c(Br)c(Br)c(O)c(Br)c2Br)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H14Br4N2O3S/c1-11-7-9-13(10-8-11)30(28,29)26-20(12-5-3-2-4-6-12)25-18-14(21)16(23)19(27)17(24)15(18)22/h2-10,27H,1H3,(H,25,26) |
| InChIKey | PLEQZBXGNCGEHX-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.03 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|