C20H14Cl3N2O3S- — CID 3637018
2,3,6-trichloro-4-[[N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]amino]phenolate (PubChem CID 3637018) has the molecular formula C20H14Cl3N2O3S- and a molecular weight of 468.77 g/mol. Its IUPAC name is 2,3,6-trichloro-4-[[N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]amino]phenolate.
| Compound Name | 2,3,6-trichloro-4-[[N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]amino]phenolate |
|---|---|
| PubChem CID | 3637018 |
| Molecular Formula | C20H14Cl3N2O3S- |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 466.98 |
| IUPAC Name | 2,3,6-trichloro-4-[[N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]amino]phenolate |
| SMILES | Cc1ccc(S(=O)(=O)N=C(Nc2cc(Cl)c([O-])c(Cl)c2Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H15Cl3N2O3S/c1-12-7-9-14(10-8-12)29(27,28)25-20(13-5-3-2-4-6-13)24-16-11-15(21)19(26)18(23)17(16)22/h2-11,26H,1H3,(H,24,25)/p-1 |
| InChIKey | WSBNYHUKYYSHMO-UHFFFAOYSA-M |
| XLogP | 5.28 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|