C20H16N4O6S — CID 6536173
N-(2,4-dinitrophenyl)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide (PubChem CID 6536173) has the molecular formula C20H16N4O6S and a molecular weight of 440.44 g/mol. Its IUPAC name is N-(2,4-dinitrophenyl)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide.
| Compound Name | N-(2,4-dinitrophenyl)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 6536173 |
| Molecular Formula | C20H16N4O6S |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | N-(2,4-dinitrophenyl)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C(\Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c2ccccc2)cc1 |
| InChI | InChI=1S/C20H16N4O6S/c1-14-7-10-17(11-8-14)31(29,30)22-20(15-5-3-2-4-6-15)21-18-12-9-16(23(25)26)13-19(18)24(27)28/h2-13H,1H3,(H,21,22) |
| InChIKey | QZFHQYDLRUNSED-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 144.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|