C40H34N4O6S3 — CID 5044534
N'-(benzenesulfonyl)-N-[4-[4-[[N-(benzenesulfonyl)-C-phenylcarbonimidoyl]sulfamoyl]-3-methylphenyl]-2-methylphenyl]benzenecarboximidamide (PubChem CID 5044534) has the molecular formula C40H34N4O6S3 and a molecular weight of 762.94 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-N-[4-[4-[[N-(benzenesulfonyl)-C-phenylcarbonimidoyl]sulfamoyl]-3-methylphenyl]-2-methylphenyl]benzenecarboximidamide.
| Compound Name | N'-(benzenesulfonyl)-N-[4-[4-[[N-(benzenesulfonyl)-C-phenylcarbonimidoyl]sulfamoyl]-3-methylphenyl]-2-methylphenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 5044534 |
| Molecular Formula | C40H34N4O6S3 |
| Molecular Weight | 762.94 g/mol |
| Exact Mass | 762.16 |
| IUPAC Name | N'-(benzenesulfonyl)-N-[4-[4-[[N-(benzenesulfonyl)-C-phenylcarbonimidoyl]sulfamoyl]-3-methylphenyl]-2-methylphenyl]benzenecarboximidamide |
| SMILES | Cc1cc(-c2ccc(S(=O)(=O)NC(=NS(=O)(=O)c3ccccc3)c3ccccc3)c(C)c2)ccc1NC(=NS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H34N4O6S3/c1-29-27-33(23-25-37(29)41-39(31-15-7-3-8-16-31)42-51(45,46)35-19-11-5-12-20-35)34-24-26-38(30(2)28-34)53(49,50)44-40(32-17-9-4-10-18-32)43-52(47,48)36-21-13-6-14-22-36/h3-28H,1-2H3,(H,41,42)(H,43,44) |
| InChIKey | MKSLNNWNMAMXDT-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 151.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.94 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|