C22H22N2O4S2 — CID 2340419
4-methyl-N,N'-bis-(4-methylphenyl)sulfonylbenzenecarboximidamide (PubChem CID 2340419) has the molecular formula C22H22N2O4S2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-methyl-N,N'-bis-(4-methylphenyl)sulfonylbenzenecarboximidamide.
| Compound Name | 4-methyl-N,N'-bis-(4-methylphenyl)sulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 2340419 |
| Molecular Formula | C22H22N2O4S2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 4-methyl-N,N'-bis-(4-methylphenyl)sulfonylbenzenecarboximidamide |
| SMILES | Cc1ccc(C(=NS(=O)(=O)c2ccc(C)cc2)NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H22N2O4S2/c1-16-4-10-19(11-5-16)22(23-29(25,26)20-12-6-17(2)7-13-20)24-30(27,28)21-14-8-18(3)9-15-21/h4-15H,1-3H3,(H,23,24) |
| InChIKey | YPBUSPXUDCSNJO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|