C17H17N2O4S- — CID 7472553
(2S)-2-[[[(4-methylphenyl)sulfonylamino]-phenylmethylidene]amino]propanoate (PubChem CID 7472553) has the molecular formula C17H17N2O4S- and a molecular weight of 345.40 g/mol. Its IUPAC name is (2S)-2-[[[(4-methylphenyl)sulfonylamino]-phenylmethylidene]amino]propanoate.
| Compound Name | (2S)-2-[[[(4-methylphenyl)sulfonylamino]-phenylmethylidene]amino]propanoate |
|---|---|
| PubChem CID | 7472553 |
| Molecular Formula | C17H17N2O4S- |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | (2S)-2-[[[(4-methylphenyl)sulfonylamino]-phenylmethylidene]amino]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)N/C(=N/[C@@H](C)C(=O)[O-])c2ccccc2)cc1 |
| InChI | InChI=1S/C17H18N2O4S/c1-12-8-10-15(11-9-12)24(22,23)19-16(18-13(2)17(20)21)14-6-4-3-5-7-14/h3-11,13H,1-2H3,(H,18,19)(H,20,21)/p-1/t13-/m0/s1 |
| InChIKey | DGRGXXXHTORCTD-ZDUSSCGKSA-M |
| XLogP | 0.86 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|