C14H13Cl2N2O3PS — CID 3514861
N'-dichlorophosphoryl-N-(4-methylphenyl)sulfonylbenzenecarboximidamide (PubChem CID 3514861) has the molecular formula C14H13Cl2N2O3PS and a molecular weight of 391.22 g/mol. Its IUPAC name is N'-dichlorophosphoryl-N-(4-methylphenyl)sulfonylbenzenecarboximidamide.
| Compound Name | N'-dichlorophosphoryl-N-(4-methylphenyl)sulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 3514861 |
| Molecular Formula | C14H13Cl2N2O3PS |
| Molecular Weight | 391.22 g/mol |
| Exact Mass | 389.98 |
| IUPAC Name | N'-dichlorophosphoryl-N-(4-methylphenyl)sulfonylbenzenecarboximidamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=NP(=O)(Cl)Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C14H13Cl2N2O3PS/c1-11-7-9-13(10-8-11)23(20,21)18-14(17-22(15,16)19)12-5-3-2-4-6-12/h2-10H,1H3,(H,17,18,19) |
| InChIKey | YMEYOMICZVXPIN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.22 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|