C17H19ClN2O2S — CID 2830707
N'-tert-butyl-N-(4-chlorophenyl)sulfonylbenzenecarboximidamide (PubChem CID 2830707) has the molecular formula C17H19ClN2O2S and a molecular weight of 350.87 g/mol. Its IUPAC name is N'-tert-butyl-N-(4-chlorophenyl)sulfonylbenzenecarboximidamide.
| Compound Name | N'-tert-butyl-N-(4-chlorophenyl)sulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 2830707 |
| Molecular Formula | C17H19ClN2O2S |
| Molecular Weight | 350.87 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N'-tert-butyl-N-(4-chlorophenyl)sulfonylbenzenecarboximidamide |
| SMILES | CC(C)(C)/N=C(/NS(=O)(=O)c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H19ClN2O2S/c1-17(2,3)19-16(13-7-5-4-6-8-13)20-23(21,22)15-11-9-14(18)10-12-15/h4-12H,1-3H3,(H,19,20) |
| InChIKey | IJKCPKMBRGFIBO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.87 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|