C16H15N2O4S- — CID 7164051
2-[[[(4-methylphenyl)sulfonylamino]-phenylmethylidene]amino]acetate (PubChem CID 7164051) has the molecular formula C16H15N2O4S- and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-[[[(4-methylphenyl)sulfonylamino]-phenylmethylidene]amino]acetate.
| Compound Name | 2-[[[(4-methylphenyl)sulfonylamino]-phenylmethylidene]amino]acetate |
|---|---|
| PubChem CID | 7164051 |
| Molecular Formula | C16H15N2O4S- |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 2-[[[(4-methylphenyl)sulfonylamino]-phenylmethylidene]amino]acetate |
| SMILES | Cc1ccc(S(=O)(=O)N/C(=N/CC(=O)[O-])c2ccccc2)cc1 |
| InChI | InChI=1S/C16H16N2O4S/c1-12-7-9-14(10-8-12)23(21,22)18-16(17-11-15(19)20)13-5-3-2-4-6-13/h2-10H,11H2,1H3,(H,17,18)(H,19,20)/p-1 |
| InChIKey | BBMKBRWNSVJSAF-UHFFFAOYSA-M |
| XLogP | 0.47 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|