C16H16N2O4S — CID 2196031
3-[[benzenesulfonamido(phenyl)methylidene]amino]propanoic acid (PubChem CID 2196031) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is 3-[[benzenesulfonamido(phenyl)methylidene]amino]propanoic acid.
| Compound Name | 3-[[benzenesulfonamido(phenyl)methylidene]amino]propanoic acid |
|---|---|
| PubChem CID | 2196031 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 3-[[benzenesulfonamido(phenyl)methylidene]amino]propanoic acid |
| SMILES | O=C(O)CC/N=C(/NS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16N2O4S/c19-15(20)11-12-17-16(13-7-3-1-4-8-13)18-23(21,22)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,17,18)(H,19,20) |
| InChIKey | HZJZWUBKCCETFH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|