C19H19N3O4S3 — CID 2346066
N'-[2-(4-sulfamoylphenyl)ethyl]-N-thiophen-2-ylsulfonylbenzenecarboximidamide (PubChem CID 2346066) has the molecular formula C19H19N3O4S3 and a molecular weight of 449.58 g/mol. Its IUPAC name is N'-[2-(4-sulfamoylphenyl)ethyl]-N-thiophen-2-ylsulfonylbenzenecarboximidamide.
| Compound Name | N'-[2-(4-sulfamoylphenyl)ethyl]-N-thiophen-2-ylsulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 2346066 |
| Molecular Formula | C19H19N3O4S3 |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | N'-[2-(4-sulfamoylphenyl)ethyl]-N-thiophen-2-ylsulfonylbenzenecarboximidamide |
| SMILES | NS(=O)(=O)c1ccc(CC/N=C(\NS(=O)(=O)c2cccs2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19N3O4S3/c20-28(23,24)17-10-8-15(9-11-17)12-13-21-19(16-5-2-1-3-6-16)22-29(25,26)18-7-4-14-27-18/h1-11,14H,12-13H2,(H,21,22)(H2,20,23,24) |
| InChIKey | BGMRTNLGJIJILM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|