C12H19N3O2S — CID 63178097
2-methyl-N'-[2-(4-sulfamoylphenyl)ethyl]propanimidamide (PubChem CID 63178097) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-methyl-N'-[2-(4-sulfamoylphenyl)ethyl]propanimidamide.
| Compound Name | 2-methyl-N'-[2-(4-sulfamoylphenyl)ethyl]propanimidamide |
|---|---|
| PubChem CID | 63178097 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-methyl-N'-[2-(4-sulfamoylphenyl)ethyl]propanimidamide |
| SMILES | CC(C)/C(N)=N\CCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H19N3O2S/c1-9(2)12(13)15-8-7-10-3-5-11(6-4-10)18(14,16)17/h3-6,9H,7-8H2,1-2H3,(H2,13,15)(H2,14,16,17) |
| InChIKey | FJJXGJPQHXNKBT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|