C12H19NO3S — CID 63201446
4-(2-hydroxy-3,3-dimethylbutyl)benzenesulfonamide (PubChem CID 63201446) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is 4-(2-hydroxy-3,3-dimethylbutyl)benzenesulfonamide.
| Compound Name | 4-(2-hydroxy-3,3-dimethylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63201446 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 4-(2-hydroxy-3,3-dimethylbutyl)benzenesulfonamide |
| SMILES | CC(C)(C)C(O)Cc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H19NO3S/c1-12(2,3)11(14)8-9-4-6-10(7-5-9)17(13,15)16/h4-7,11,14H,8H2,1-3H3,(H2,13,15,16) |
| InChIKey | RSZRHDNBQLYWEF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |