C15H24O3S — CID 63200994
3,3-dimethyl-1-(4-propylsulfonylphenyl)butan-2-ol (PubChem CID 63200994) has the molecular formula C15H24O3S and a molecular weight of 284.42 g/mol. Its IUPAC name is 3,3-dimethyl-1-(4-propylsulfonylphenyl)butan-2-ol.
| Compound Name | 3,3-dimethyl-1-(4-propylsulfonylphenyl)butan-2-ol |
|---|---|
| PubChem CID | 63200994 |
| Molecular Formula | C15H24O3S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 3,3-dimethyl-1-(4-propylsulfonylphenyl)butan-2-ol |
| SMILES | CCCS(=O)(=O)c1ccc(CC(O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H24O3S/c1-5-10-19(17,18)13-8-6-12(7-9-13)11-14(16)15(2,3)4/h6-9,14,16H,5,10-11H2,1-4H3 |
| InChIKey | BTTDCNMJNTVUEJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |