C10H14N2O3S — CID 145476026
4-(4-sulfamoylphenyl)butanamide (PubChem CID 145476026) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 4-(4-sulfamoylphenyl)butanamide.
| Compound Name | 4-(4-sulfamoylphenyl)butanamide |
|---|---|
| PubChem CID | 145476026 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 4-(4-sulfamoylphenyl)butanamide |
| SMILES | NC(=O)CCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C10H14N2O3S/c11-10(13)3-1-2-8-4-6-9(7-5-8)16(12,14)15/h4-7H,1-3H2,(H2,11,13)(H2,12,14,15) |
| InChIKey | XEPTWRKPNTXKRE-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |