C19H23NO6S — CID 171550008
2,3-dihydroxypropyl 4-[4-(4-sulfamoylphenyl)phenyl]butanoate (PubChem CID 171550008) has the molecular formula C19H23NO6S and a molecular weight of 393.46 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 4-[4-(4-sulfamoylphenyl)phenyl]butanoate.
| Compound Name | 2,3-dihydroxypropyl 4-[4-(4-sulfamoylphenyl)phenyl]butanoate |
|---|---|
| PubChem CID | 171550008 |
| Molecular Formula | C19H23NO6S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2,3-dihydroxypropyl 4-[4-(4-sulfamoylphenyl)phenyl]butanoate |
| SMILES | NS(=O)(=O)c1ccc(-c2ccc(CCCC(=O)OCC(O)CO)cc2)cc1 |
| InChI | InChI=1S/C19H23NO6S/c20-27(24,25)18-10-8-16(9-11-18)15-6-4-14(5-7-15)2-1-3-19(23)26-13-17(22)12-21/h4-11,17,21-22H,1-3,12-13H2,(H2,20,24,25) |
| InChIKey | PUPATHWWUJTYKG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |