C25H35NO4S — CID 171550021
2,3-dihydroxypropyl 4-[4-[4-(dipropylamino)sulfanylphenyl]phenyl]butanoate (PubChem CID 171550021) has the molecular formula C25H35NO4S and a molecular weight of 445.63 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 4-[4-[4-(dipropylamino)sulfanylphenyl]phenyl]butanoate.
| Compound Name | 2,3-dihydroxypropyl 4-[4-[4-(dipropylamino)sulfanylphenyl]phenyl]butanoate |
|---|---|
| PubChem CID | 171550021 |
| Molecular Formula | C25H35NO4S |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 2,3-dihydroxypropyl 4-[4-[4-(dipropylamino)sulfanylphenyl]phenyl]butanoate |
| SMILES | CCCN(CCC)Sc1ccc(-c2ccc(CCCC(=O)OCC(O)CO)cc2)cc1 |
| InChI | InChI=1S/C25H35NO4S/c1-3-16-26(17-4-2)31-24-14-12-22(13-15-24)21-10-8-20(9-11-21)6-5-7-25(29)30-19-23(28)18-27/h8-15,23,27-28H,3-7,16-19H2,1-2H3 |
| InChIKey | SHJIPJVLJJHQBT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|