C13H21N5O3S — CID 118707446
4-(diaminomethylideneamino)-N-[2-(4-sulfamoylphenyl)ethyl]butanamide (PubChem CID 118707446) has the molecular formula C13H21N5O3S and a molecular weight of 327.41 g/mol. Its IUPAC name is 4-(diaminomethylideneamino)-N-[2-(4-sulfamoylphenyl)ethyl]butanamide.
| Compound Name | 4-(diaminomethylideneamino)-N-[2-(4-sulfamoylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 118707446 |
| Molecular Formula | C13H21N5O3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 4-(diaminomethylideneamino)-N-[2-(4-sulfamoylphenyl)ethyl]butanamide |
| SMILES | NC(N)=NCCCC(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H21N5O3S/c14-13(15)18-8-1-2-12(19)17-9-7-10-3-5-11(6-4-10)22(16,20)21/h3-6H,1-2,7-9H2,(H,17,19)(H4,14,15,18)(H2,16,20,21) |
| InChIKey | GUYIJMMRBVHRBY-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|