C18H19BrN2O4S — CID 27538363
4-(4-bromophenyl)-4-oxo-N-[2-(4-sulfamoylphenyl)ethyl]butanamide (PubChem CID 27538363) has the molecular formula C18H19BrN2O4S and a molecular weight of 439.33 g/mol. Its IUPAC name is 4-(4-bromophenyl)-4-oxo-N-[2-(4-sulfamoylphenyl)ethyl]butanamide.
| Compound Name | 4-(4-bromophenyl)-4-oxo-N-[2-(4-sulfamoylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 27538363 |
| Molecular Formula | C18H19BrN2O4S |
| Molecular Weight | 439.33 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | 4-(4-bromophenyl)-4-oxo-N-[2-(4-sulfamoylphenyl)ethyl]butanamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)CCC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C18H19BrN2O4S/c19-15-5-3-14(4-6-15)17(22)9-10-18(23)21-12-11-13-1-7-16(8-2-13)26(20,24)25/h1-8H,9-12H2,(H,21,23)(H2,20,24,25) |
| InChIKey | SMFMSOZXLTUNAW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |