C20H24N2O4S — CID 27538895
4-(3,4-dimethylphenyl)-4-oxo-N-[2-(4-sulfamoylphenyl)ethyl]butanamide (PubChem CID 27538895) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-4-oxo-N-[2-(4-sulfamoylphenyl)ethyl]butanamide.
| Compound Name | 4-(3,4-dimethylphenyl)-4-oxo-N-[2-(4-sulfamoylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 27538895 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-4-oxo-N-[2-(4-sulfamoylphenyl)ethyl]butanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)NCCc2ccc(S(N)(=O)=O)cc2)cc1C |
| InChI | InChI=1S/C20H24N2O4S/c1-14-3-6-17(13-15(14)2)19(23)9-10-20(24)22-12-11-16-4-7-18(8-5-16)27(21,25)26/h3-8,13H,9-12H2,1-2H3,(H,22,24)(H2,21,25,26) |
| InChIKey | LUQCJRRPEBONJF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |