C19H17N2O3S2- — CID 2380509
N-(2-phenylethyl)-2-(thiophen-2-ylsulfonylamino)benzenecarboximidate (PubChem CID 2380509) has the molecular formula C19H17N2O3S2- and a molecular weight of 385.49 g/mol. Its IUPAC name is N-(2-phenylethyl)-2-(thiophen-2-ylsulfonylamino)benzenecarboximidate.
| Compound Name | N-(2-phenylethyl)-2-(thiophen-2-ylsulfonylamino)benzenecarboximidate |
|---|---|
| PubChem CID | 2380509 |
| Molecular Formula | C19H17N2O3S2- |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | N-(2-phenylethyl)-2-(thiophen-2-ylsulfonylamino)benzenecarboximidate |
| SMILES | O=S(=O)(Nc1ccccc1/C([O-])=N/CCc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C19H18N2O3S2/c22-19(20-13-12-15-7-2-1-3-8-15)16-9-4-5-10-17(16)21-26(23,24)18-11-6-14-25-18/h1-11,14,21H,12-13H2,(H,20,22)/p-1 |
| InChIKey | YYYRWLZZVUNIAO-UHFFFAOYSA-M |
| XLogP | 2.90 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|