C20H19N2O3S2- — CID 2336215
N-(2-ethyl-6-methylphenyl)-2-(thiophen-2-ylsulfonylamino)benzenecarboximidate (PubChem CID 2336215) has the molecular formula C20H19N2O3S2- and a molecular weight of 399.52 g/mol. Its IUPAC name is N-(2-ethyl-6-methylphenyl)-2-(thiophen-2-ylsulfonylamino)benzenecarboximidate.
| Compound Name | N-(2-ethyl-6-methylphenyl)-2-(thiophen-2-ylsulfonylamino)benzenecarboximidate |
|---|---|
| PubChem CID | 2336215 |
| Molecular Formula | C20H19N2O3S2- |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | N-(2-ethyl-6-methylphenyl)-2-(thiophen-2-ylsulfonylamino)benzenecarboximidate |
| SMILES | CCc1cccc(C)c1/N=C(\[O-])c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C20H20N2O3S2/c1-3-15-9-6-8-14(2)19(15)21-20(23)16-10-4-5-11-17(16)22-27(24,25)18-12-7-13-26-18/h4-13,22H,3H2,1-2H3,(H,21,23)/p-1 |
| InChIKey | OPGCYCKENKNMBZ-UHFFFAOYSA-M |
| XLogP | 3.86 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|