C18H15N4O3S2- — CID 2431556
N-(1-pyridin-4-ylethenyl)-2-(thiophen-2-ylsulfonylamino)benzenecarbohydrazonate (PubChem CID 2431556) has the molecular formula C18H15N4O3S2- and a molecular weight of 399.48 g/mol. Its IUPAC name is N-(1-pyridin-4-ylethenyl)-2-(thiophen-2-ylsulfonylamino)benzenecarbohydrazonate.
| Compound Name | N-(1-pyridin-4-ylethenyl)-2-(thiophen-2-ylsulfonylamino)benzenecarbohydrazonate |
|---|---|
| PubChem CID | 2431556 |
| Molecular Formula | C18H15N4O3S2- |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | N-(1-pyridin-4-ylethenyl)-2-(thiophen-2-ylsulfonylamino)benzenecarbohydrazonate |
| SMILES | C=C(NN=C([O-])c1ccccc1NS(=O)(=O)c1cccs1)c1ccncc1 |
| InChI | InChI=1S/C18H16N4O3S2/c1-13(14-8-10-19-11-9-14)20-21-18(23)15-5-2-3-6-16(15)22-27(24,25)17-7-4-12-26-17/h2-12,20,22H,1H2,(H,21,23)/p-1 |
| InChIKey | VTCWOGRBJPSIRD-UHFFFAOYSA-M |
| XLogP | 2.23 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|