C17H13N4O3S2- — CID 6783266
(NZ)-N-(pyridin-4-ylmethylidene)-2-(thiophen-2-ylsulfonylamino)benzenecarbohydrazonate (PubChem CID 6783266) has the molecular formula C17H13N4O3S2- and a molecular weight of 385.45 g/mol. Its IUPAC name is (NZ)-N-(pyridin-4-ylmethylidene)-2-(thiophen-2-ylsulfonylamino)benzenecarbohydrazonate.
| Compound Name | (NZ)-N-(pyridin-4-ylmethylidene)-2-(thiophen-2-ylsulfonylamino)benzenecarbohydrazonate |
|---|---|
| PubChem CID | 6783266 |
| Molecular Formula | C17H13N4O3S2- |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | (NZ)-N-(pyridin-4-ylmethylidene)-2-(thiophen-2-ylsulfonylamino)benzenecarbohydrazonate |
| SMILES | O=S(=O)(Nc1ccccc1C([O-])=N/N=C\c1ccncc1)c1cccs1 |
| InChI | InChI=1S/C17H14N4O3S2/c22-17(20-19-12-13-7-9-18-10-8-13)14-4-1-2-5-15(14)21-26(23,24)16-6-3-11-25-16/h1-12,21H,(H,20,22)/p-1/b19-12- |
| InChIKey | GUXQDZBFMYGDHV-UNOMPAQXSA-M |
| XLogP | 2.08 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|