C21H19N4O4S2- — CID 2366530
N-[1-(3-acetamidophenyl)ethenyl]-2-(thiophen-2-ylsulfonylamino)benzenecarbohydrazonate (PubChem CID 2366530) has the molecular formula C21H19N4O4S2- and a molecular weight of 455.54 g/mol. Its IUPAC name is N-[1-(3-acetamidophenyl)ethenyl]-2-(thiophen-2-ylsulfonylamino)benzenecarbohydrazonate.
| Compound Name | N-[1-(3-acetamidophenyl)ethenyl]-2-(thiophen-2-ylsulfonylamino)benzenecarbohydrazonate |
|---|---|
| PubChem CID | 2366530 |
| Molecular Formula | C21H19N4O4S2- |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | N-[1-(3-acetamidophenyl)ethenyl]-2-(thiophen-2-ylsulfonylamino)benzenecarbohydrazonate |
| SMILES | C=C(NN=C([O-])c1ccccc1NS(=O)(=O)c1cccs1)c1cccc(NC(C)=O)c1 |
| InChI | InChI=1S/C21H20N4O4S2/c1-14(16-7-5-8-17(13-16)22-15(2)26)23-24-21(27)18-9-3-4-10-19(18)25-31(28,29)20-11-6-12-30-20/h3-13,23,25H,1H2,2H3,(H,22,26)(H,24,27)/p-1 |
| InChIKey | OATLZOCQKGJMLX-UHFFFAOYSA-M |
| XLogP | 2.79 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|