C25H24N2O3S3 — CID 40589296
N-benzyl-N-[(2R)-1-thiophen-2-ylpropan-2-yl]-2-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 40589296) has the molecular formula C25H24N2O3S3 and a molecular weight of 496.68 g/mol. Its IUPAC name is N-benzyl-N-[(2R)-1-thiophen-2-ylpropan-2-yl]-2-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-benzyl-N-[(2R)-1-thiophen-2-ylpropan-2-yl]-2-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 40589296 |
| Molecular Formula | C25H24N2O3S3 |
| Molecular Weight | 496.68 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | N-benzyl-N-[(2R)-1-thiophen-2-ylpropan-2-yl]-2-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | C[C@H](Cc1cccs1)N(Cc1ccccc1)C(=O)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C25H24N2O3S3/c1-19(17-21-11-7-15-31-21)27(18-20-9-3-2-4-10-20)25(28)22-12-5-6-13-23(22)26-33(29,30)24-14-8-16-32-24/h2-16,19,26H,17-18H2,1H3/t19-/m1/s1 |
| InChIKey | WKDSOIPUCFMXLK-LJQANCHMSA-N |
| XLogP | 5.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.68 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |