C23H27N3O3S2 — CID 52524558
1-benzyl-3-[4-(dimethylsulfamoyl)phenyl]-1-[(2R)-1-thiophen-2-ylpropan-2-yl]urea (PubChem CID 52524558) has the molecular formula C23H27N3O3S2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 1-benzyl-3-[4-(dimethylsulfamoyl)phenyl]-1-[(2R)-1-thiophen-2-ylpropan-2-yl]urea.
| Compound Name | 1-benzyl-3-[4-(dimethylsulfamoyl)phenyl]-1-[(2R)-1-thiophen-2-ylpropan-2-yl]urea |
|---|---|
| PubChem CID | 52524558 |
| Molecular Formula | C23H27N3O3S2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 1-benzyl-3-[4-(dimethylsulfamoyl)phenyl]-1-[(2R)-1-thiophen-2-ylpropan-2-yl]urea |
| SMILES | C[C@H](Cc1cccs1)N(Cc1ccccc1)C(=O)Nc1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C23H27N3O3S2/c1-18(16-21-10-7-15-30-21)26(17-19-8-5-4-6-9-19)23(27)24-20-11-13-22(14-12-20)31(28,29)25(2)3/h4-15,18H,16-17H2,1-3H3,(H,24,27)/t18-/m1/s1 |
| InChIKey | GSWLUNMOQYCYPK-GOSISDBHSA-N |
| XLogP | 4.66 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |