C14H18N2O3S2 — CID 144812219
N,N-dimethylbenzenesulfonamide;2-thiophen-2-ylacetamide (PubChem CID 144812219) has the molecular formula C14H18N2O3S2 and a molecular weight of 326.44 g/mol. Its IUPAC name is N,N-dimethylbenzenesulfonamide;2-thiophen-2-ylacetamide.
| Compound Name | N,N-dimethylbenzenesulfonamide;2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 144812219 |
| Molecular Formula | C14H18N2O3S2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N,N-dimethylbenzenesulfonamide;2-thiophen-2-ylacetamide |
| SMILES | CN(C)S(=O)(=O)c1ccccc1.NC(=O)Cc1cccs1 |
| InChI | InChI=1S/C8H11NO2S.C6H7NOS/c1-9(2)12(10,11)8-6-4-3-5-7-8;7-6(8)4-5-2-1-3-9-5/h3-7H,1-2H3;1-3H,4H2,(H2,7,8) |
| InChIKey | VEQFMWWHQQNVNQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |