C13H15NO3S2 — CID 110663687
N-(2-hydroxy-2-thiophen-2-ylethyl)-N-methylbenzenesulfonamide (PubChem CID 110663687) has the molecular formula C13H15NO3S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-2-ylethyl)-N-methylbenzenesulfonamide.
| Compound Name | N-(2-hydroxy-2-thiophen-2-ylethyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 110663687 |
| Molecular Formula | C13H15NO3S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-2-ylethyl)-N-methylbenzenesulfonamide |
| SMILES | CN(CC(O)c1cccs1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H15NO3S2/c1-14(10-12(15)13-8-5-9-18-13)19(16,17)11-6-3-2-4-7-11/h2-9,12,15H,10H2,1H3 |
| InChIKey | BTLONRNIMUZSEZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |