C15H16INO3S — CID 4982665
N-(2-hydroxy-2-phenylethyl)-4-iodo-N-methylbenzenesulfonamide (PubChem CID 4982665) has the molecular formula C15H16INO3S and a molecular weight of 417.27 g/mol. Its IUPAC name is N-(2-hydroxy-2-phenylethyl)-4-iodo-N-methylbenzenesulfonamide.
| Compound Name | N-(2-hydroxy-2-phenylethyl)-4-iodo-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 4982665 |
| Molecular Formula | C15H16INO3S |
| Molecular Weight | 417.27 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | N-(2-hydroxy-2-phenylethyl)-4-iodo-N-methylbenzenesulfonamide |
| SMILES | CN(CC(O)c1ccccc1)S(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C15H16INO3S/c1-17(11-15(18)12-5-3-2-4-6-12)21(19,20)14-9-7-13(16)8-10-14/h2-10,15,18H,11H2,1H3 |
| InChIKey | VNXJWMVIXGYJRF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|