C17H17BrNO4S- — CID 3463211
4-[(4-bromophenyl)sulfonyl-methylamino]-3-phenylbutanoate (PubChem CID 3463211) has the molecular formula C17H17BrNO4S- and a molecular weight of 411.30 g/mol. Its IUPAC name is 4-[(4-bromophenyl)sulfonyl-methylamino]-3-phenylbutanoate.
| Compound Name | 4-[(4-bromophenyl)sulfonyl-methylamino]-3-phenylbutanoate |
|---|---|
| PubChem CID | 3463211 |
| Molecular Formula | C17H17BrNO4S- |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | 4-[(4-bromophenyl)sulfonyl-methylamino]-3-phenylbutanoate |
| SMILES | CN(CC(CC(=O)[O-])c1ccccc1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H18BrNO4S/c1-19(24(22,23)16-9-7-15(18)8-10-16)12-14(11-17(20)21)13-5-3-2-4-6-13/h2-10,14H,11-12H2,1H3,(H,20,21)/p-1 |
| InChIKey | ZAYJNNROIJHMNP-UHFFFAOYSA-M |
| XLogP | 1.99 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |