C11H16BrN3O3S — CID 54991645
3-[(4-bromophenyl)sulfonyl-methylamino]-N'-hydroxy-2-methylpropanimidamide (PubChem CID 54991645) has the molecular formula C11H16BrN3O3S and a molecular weight of 350.24 g/mol. Its IUPAC name is 3-[(4-bromophenyl)sulfonyl-methylamino]-N'-hydroxy-2-methylpropanimidamide.
| Compound Name | 3-[(4-bromophenyl)sulfonyl-methylamino]-N'-hydroxy-2-methylpropanimidamide |
|---|---|
| PubChem CID | 54991645 |
| Molecular Formula | C11H16BrN3O3S |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 3-[(4-bromophenyl)sulfonyl-methylamino]-N'-hydroxy-2-methylpropanimidamide |
| SMILES | CC(CN(C)S(=O)(=O)c1ccc(Br)cc1)/C(N)=N/O |
| InChI | InChI=1S/C11H16BrN3O3S/c1-8(11(13)14-16)7-15(2)19(17,18)10-5-3-9(12)4-6-10/h3-6,8,16H,7H2,1-2H3,(H2,13,14) |
| InChIKey | FOFVDLPYNIAMJD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|