C26H32N2O2S2 — CID 102462473
N-methyl-N-[(2S)-4-(4-phenylpiperidin-1-yl)-2-thiophen-2-ylbutyl]benzenesulfonamide (PubChem CID 102462473) has the molecular formula C26H32N2O2S2 and a molecular weight of 468.69 g/mol. Its IUPAC name is N-methyl-N-[(2S)-4-(4-phenylpiperidin-1-yl)-2-thiophen-2-ylbutyl]benzenesulfonamide.
| Compound Name | N-methyl-N-[(2S)-4-(4-phenylpiperidin-1-yl)-2-thiophen-2-ylbutyl]benzenesulfonamide |
|---|---|
| PubChem CID | 102462473 |
| Molecular Formula | C26H32N2O2S2 |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | N-methyl-N-[(2S)-4-(4-phenylpiperidin-1-yl)-2-thiophen-2-ylbutyl]benzenesulfonamide |
| SMILES | CN(C[C@H](CCN1CCC(c2ccccc2)CC1)c1cccs1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H32N2O2S2/c1-27(32(29,30)25-11-6-3-7-12-25)21-24(26-13-8-20-31-26)16-19-28-17-14-23(15-18-28)22-9-4-2-5-10-22/h2-13,20,23-24H,14-19,21H2,1H3/t24-/m0/s1 |
| InChIKey | BWMWEXXFAXIRIO-DEOSSOPVSA-N |
| XLogP | 5.42 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |