C31H37N3O4S2 — CID 18407123
benzyl N-[1-[4-[benzenesulfonyl(methyl)amino]-3-thiophen-2-ylbutyl]piperidin-4-yl]-N-prop-2-ynylcarbamate (PubChem CID 18407123) has the molecular formula C31H37N3O4S2 and a molecular weight of 579.79 g/mol. Its IUPAC name is benzyl N-[1-[4-[benzenesulfonyl(methyl)amino]-3-thiophen-2-ylbutyl]piperidin-4-yl]-N-prop-2-ynylcarbamate.
| Compound Name | benzyl N-[1-[4-[benzenesulfonyl(methyl)amino]-3-thiophen-2-ylbutyl]piperidin-4-yl]-N-prop-2-ynylcarbamate |
|---|---|
| PubChem CID | 18407123 |
| Molecular Formula | C31H37N3O4S2 |
| Molecular Weight | 579.79 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | benzyl N-[1-[4-[benzenesulfonyl(methyl)amino]-3-thiophen-2-ylbutyl]piperidin-4-yl]-N-prop-2-ynylcarbamate |
| SMILES | C#CCN(C(=O)OCc1ccccc1)C1CCN(CCC(CN(C)S(=O)(=O)c2ccccc2)c2cccs2)CC1 |
| InChI | InChI=1S/C31H37N3O4S2/c1-3-19-34(31(35)38-25-26-11-6-4-7-12-26)28-17-21-33(22-18-28)20-16-27(30-15-10-23-39-30)24-32(2)40(36,37)29-13-8-5-9-14-29/h1,4-15,23,27-28H,16-22,24-25H2,2H3 |
| InChIKey | GXWVEWOYRIEGOK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.79 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|