C32H37Cl2N5O6S — CID 22893970
(4-nitrophenyl)methyl N-[1-[(3S)-4-[benzenesulfonyl(methyl)amino]-3-(3-chlorophenyl)butyl]piperidin-4-yl]-N-(cyanomethyl)carbamate;hydrochloride (PubChem CID 22893970) has the molecular formula C32H37Cl2N5O6S and a molecular weight of 690.65 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[1-[(3S)-4-[benzenesulfonyl(methyl)amino]-3-(3-chlorophenyl)butyl]piperidin-4-yl]-N-(cyanomethyl)carbamate;hydrochloride.
| Compound Name | (4-nitrophenyl)methyl N-[1-[(3S)-4-[benzenesulfonyl(methyl)amino]-3-(3-chlorophenyl)butyl]piperidin-4-yl]-N-(cyanomethyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 22893970 |
| Molecular Formula | C32H37Cl2N5O6S |
| Molecular Weight | 690.65 g/mol |
| Exact Mass | 689.18 |
| IUPAC Name | (4-nitrophenyl)methyl N-[1-[(3S)-4-[benzenesulfonyl(methyl)amino]-3-(3-chlorophenyl)butyl]piperidin-4-yl]-N-(cyanomethyl)carbamate;hydrochloride |
| SMILES | CN(C[C@@H](CCN1CCC(N(CC#N)C(=O)OCc2ccc([N+](=O)[O-])cc2)CC1)c1cccc(Cl)c1)S(=O)(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C32H36ClN5O6S.ClH/c1-35(45(42,43)31-8-3-2-4-9-31)23-27(26-6-5-7-28(33)22-26)14-18-36-19-15-29(16-20-36)37(21-17-34)32(39)44-24-25-10-12-30(13-11-25)38(40)41;/h2-13,22,27,29H,14-16,18-21,23-24H2,1H3;1H/t27-;/m1./s1 |
| InChIKey | ZHWOFLJTRLEPOT-HZPIKELBSA-N |
| XLogP | 6.09 |
| TPSA | 137.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.65 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|