C26H37ClN2O2S — CID 23285252
N-[4-(4-tert-butylpiperidin-1-yl)-2-(3-chlorophenyl)butyl]-N-methylbenzenesulfonamide (PubChem CID 23285252) has the molecular formula C26H37ClN2O2S and a molecular weight of 477.11 g/mol. Its IUPAC name is N-[4-(4-tert-butylpiperidin-1-yl)-2-(3-chlorophenyl)butyl]-N-methylbenzenesulfonamide.
| Compound Name | N-[4-(4-tert-butylpiperidin-1-yl)-2-(3-chlorophenyl)butyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 23285252 |
| Molecular Formula | C26H37ClN2O2S |
| Molecular Weight | 477.11 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | N-[4-(4-tert-butylpiperidin-1-yl)-2-(3-chlorophenyl)butyl]-N-methylbenzenesulfonamide |
| SMILES | CN(CC(CCN1CCC(C(C)(C)C)CC1)c1cccc(Cl)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H37ClN2O2S/c1-26(2,3)23-14-17-29(18-15-23)16-13-22(21-9-8-10-24(27)19-21)20-28(4)32(30,31)25-11-6-5-7-12-25/h5-12,19,22-23H,13-18,20H2,1-4H3 |
| InChIKey | FIDIUXOFRTVBPX-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.11 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |